C11H25N3O — CID 120848866
(2R)-1-[4-(2-amino-2-methylpropyl)piperazin-1-yl]propan-2-ol (PubChem CID 120848866) has the molecular formula C11H25N3O and a molecular weight of 215.34 g/mol. Its IUPAC name is (2R)-1-[4-(2-amino-2-methylpropyl)piperazin-1-yl]propan-2-ol.
| Compound Name | (2R)-1-[4-(2-amino-2-methylpropyl)piperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 120848866 |
| Molecular Formula | C11H25N3O |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.20 |
| IUPAC Name | (2R)-1-[4-(2-amino-2-methylpropyl)piperazin-1-yl]propan-2-ol |
| SMILES | C[C@@H](O)CN1CCN(CC(C)(C)N)CC1 |
| InChI | InChI=1S/C11H25N3O/c1-10(15)8-13-4-6-14(7-5-13)9-11(2,3)12/h10,15H,4-9,12H2,1-3H3/t10-/m1/s1 |
| InChIKey | MXBLYFXVZAJLCG-SNVBAGLBSA-N |
| XLogP | -0.28 |
| TPSA | 52.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |