C15H33N3O3 — CID 4961557
1-[4,7-bis(2-hydroxypropyl)-1,4,7-triazonan-1-yl]propan-2-ol (PubChem CID 4961557) has the molecular formula C15H33N3O3 and a molecular weight of 303.45 g/mol. Its IUPAC name is 1-[4,7-bis(2-hydroxypropyl)-1,4,7-triazonan-1-yl]propan-2-ol.
| Compound Name | 1-[4,7-bis(2-hydroxypropyl)-1,4,7-triazonan-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 4961557 |
| Molecular Formula | C15H33N3O3 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.25 |
| IUPAC Name | 1-[4,7-bis(2-hydroxypropyl)-1,4,7-triazonan-1-yl]propan-2-ol |
| SMILES | CC(O)CN1CCN(CC(C)O)CCN(CC(C)O)CC1 |
| InChI | InChI=1S/C15H33N3O3/c1-13(19)10-16-4-6-17(11-14(2)20)8-9-18(7-5-16)12-15(3)21/h13-15,19-21H,4-12H2,1-3H3 |
| InChIKey | KZLMKKPAAQYKFX-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 70.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |