C12H27N3O — CID 64788004
2-amino-2-methyl-3-[4-(2-methylpropyl)piperazin-1-yl]propan-1-ol (PubChem CID 64788004) has the molecular formula C12H27N3O and a molecular weight of 229.37 g/mol. Its IUPAC name is 2-amino-2-methyl-3-[4-(2-methylpropyl)piperazin-1-yl]propan-1-ol.
| Compound Name | 2-amino-2-methyl-3-[4-(2-methylpropyl)piperazin-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 64788004 |
| Molecular Formula | C12H27N3O |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.22 |
| IUPAC Name | 2-amino-2-methyl-3-[4-(2-methylpropyl)piperazin-1-yl]propan-1-ol |
| SMILES | CC(C)CN1CCN(CC(C)(N)CO)CC1 |
| InChI | InChI=1S/C12H27N3O/c1-11(2)8-14-4-6-15(7-5-14)9-12(3,13)10-16/h11,16H,4-10,13H2,1-3H3 |
| InChIKey | CRIYNDPFZXQLOC-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 52.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |