C10H18N2O2 — CID 163614690
3-(4-prop-1-ynylpiperazin-1-yl)propane-1,2-diol (PubChem CID 163614690) has the molecular formula C10H18N2O2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 3-(4-prop-1-ynylpiperazin-1-yl)propane-1,2-diol.
| Compound Name | 3-(4-prop-1-ynylpiperazin-1-yl)propane-1,2-diol |
|---|---|
| PubChem CID | 163614690 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 3-(4-prop-1-ynylpiperazin-1-yl)propane-1,2-diol |
| SMILES | CC#CN1CCN(CC(O)CO)CC1 |
| InChI | InChI=1S/C10H18N2O2/c1-2-3-11-4-6-12(7-5-11)8-10(14)9-13/h10,13-14H,4-9H2,1H3 |
| InChIKey | HIZCEYGFZOKZNG-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|