C13H17NO3 — CID 113422849
2-(2,3-dihydroxypropyl)-4,5-dihydro-3H-2-benzazepin-1-one (PubChem CID 113422849) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is 2-(2,3-dihydroxypropyl)-4,5-dihydro-3H-2-benzazepin-1-one.
| Compound Name | 2-(2,3-dihydroxypropyl)-4,5-dihydro-3H-2-benzazepin-1-one |
|---|---|
| PubChem CID | 113422849 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 2-(2,3-dihydroxypropyl)-4,5-dihydro-3H-2-benzazepin-1-one |
| SMILES | O=C1c2ccccc2CCCN1CC(O)CO |
| InChI | InChI=1S/C13H17NO3/c15-9-11(16)8-14-7-3-5-10-4-1-2-6-12(10)13(14)17/h1-2,4,6,11,15-16H,3,5,7-9H2 |
| InChIKey | HOEZUEGUJOSQGY-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |