C11H13NO2 — CID 103552413
3-but-3-ynyl-3-azabicyclo[3.2.1]octane-2,4-dione (PubChem CID 103552413) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is 3-but-3-ynyl-3-azabicyclo[3.2.1]octane-2,4-dione.
| Compound Name | 3-but-3-ynyl-3-azabicyclo[3.2.1]octane-2,4-dione |
|---|---|
| PubChem CID | 103552413 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 3-but-3-ynyl-3-azabicyclo[3.2.1]octane-2,4-dione |
| SMILES | C#CCCN1C(=O)C2CCC(C2)C1=O |
| InChI | InChI=1S/C11H13NO2/c1-2-3-6-12-10(13)8-4-5-9(7-8)11(12)14/h1,8-9H,3-7H2 |
| InChIKey | AJZKNUILORBFDE-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|