C11H16N4O2 — CID 154628690
1-but-3-ynyl-3,7-dimethyl-4,5,8,9-tetrahydropurine-2,6-dione (PubChem CID 154628690) has the molecular formula C11H16N4O2 and a molecular weight of 236.27 g/mol. Its IUPAC name is 1-but-3-ynyl-3,7-dimethyl-4,5,8,9-tetrahydropurine-2,6-dione.
| Compound Name | 1-but-3-ynyl-3,7-dimethyl-4,5,8,9-tetrahydropurine-2,6-dione |
|---|---|
| PubChem CID | 154628690 |
| Molecular Formula | C11H16N4O2 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 1-but-3-ynyl-3,7-dimethyl-4,5,8,9-tetrahydropurine-2,6-dione |
| SMILES | C#CCCN1C(=O)C2C(NCN2C)N(C)C1=O |
| InChI | InChI=1S/C11H16N4O2/c1-4-5-6-15-10(16)8-9(12-7-13(8)2)14(3)11(15)17/h1,8-9,12H,5-7H2,2-3H3 |
| InChIKey | NQHKUFVVTDBSAX-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|