C10H14N2O2 — CID 66069047
1-but-3-ynyl-3,3-dimethylpiperazine-2,6-dione (PubChem CID 66069047) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 1-but-3-ynyl-3,3-dimethylpiperazine-2,6-dione.
| Compound Name | 1-but-3-ynyl-3,3-dimethylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 66069047 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 1-but-3-ynyl-3,3-dimethylpiperazine-2,6-dione |
| SMILES | C#CCCN1C(=O)CNC(C)(C)C1=O |
| InChI | InChI=1S/C10H14N2O2/c1-4-5-6-12-8(13)7-11-10(2,3)9(12)14/h1,11H,5-7H2,2-3H3 |
| InChIKey | CHYCXJOQZBEKOK-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|