About 1-but-3-ynyl-3,3-dimethylpiperazine-2,6-dione
1-but-3-ynyl-3,3-dimethylpiperazine-2,6-dione (PubChem CID 66069047) has the molecular formula C10H14N2O2
and a molecular weight of 194.23 g/mol. Its IUPAC name is 1-but-3-ynyl-3,3-dimethylpiperazine-2,6-dione.
Molecular Properties
| Compound Name | 1-but-3-ynyl-3,3-dimethylpiperazine-2,6-dione |
| PubChem CID | 66069047 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 1-but-3-ynyl-3,3-dimethylpiperazine-2,6-dione |
| SMILES | C#CCCN1C(=O)CNC(C)(C)C1=O |
| InChI | InChI=1S/C10H14N2O2/c1-4-5-6-12-8(13)7-11-10(2,3)9(12)14/h1,11H,5-7H2,2-3H3 |
| InChIKey | CHYCXJOQZBEKOK-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-but-3-ynyl-3,3-dimethylpiperazine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-but-3-ynyl-3,3-dimethylpiperazine-2,6-dione?
The IUPAC name of 1-but-3-ynyl-3,3-dimethylpiperazine-2,6-dione (CID 66069047) is 1-but-3-ynyl-3,3-dimethylpiperazine-2,6-dione.
What is the SMILES notation for 1-but-3-ynyl-3,3-dimethylpiperazine-2,6-dione?
The canonical SMILES for 1-but-3-ynyl-3,3-dimethylpiperazine-2,6-dione is C#CCCN1C(=O)CNC(C)(C)C1=O.
What is the InChIKey of 1-but-3-ynyl-3,3-dimethylpiperazine-2,6-dione?
The InChIKey is CHYCXJOQZBEKOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O2/c1-4-5-6-12-8(13)7-11-10(2,3)9(12)14/h1,11H,5-7H2,2-3H3.
What are the key properties of 1-but-3-ynyl-3,3-dimethylpiperazine-2,6-dione?
1-but-3-ynyl-3,3-dimethylpiperazine-2,6-dione has a molecular weight of 194.23 g/mol, XLogP of -0.25, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-but-3-ynyl-3,3-dimethylpiperazine-2,6-dione is sourced from PubChem (CID 66069047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).