C15H23NO5S2 — CID 10361230
methyl 2-[(1R,2R,4S)-3-ethoxycarbothioylsulfanyl-2-bicyclo[2.2.1]heptanyl]-2-(methoxycarbonylamino)acetate (PubChem CID 10361230) has the molecular formula C15H23NO5S2 and a molecular weight of 361.49 g/mol. Its IUPAC name is methyl 2-[(1R,2R,4S)-3-ethoxycarbothioylsulfanyl-2-bicyclo[2.2.1]heptanyl]-2-(methoxycarbonylamino)acetate.
| Compound Name | methyl 2-[(1R,2R,4S)-3-ethoxycarbothioylsulfanyl-2-bicyclo[2.2.1]heptanyl]-2-(methoxycarbonylamino)acetate |
|---|---|
| PubChem CID | 10361230 |
| Molecular Formula | C15H23NO5S2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | methyl 2-[(1R,2R,4S)-3-ethoxycarbothioylsulfanyl-2-bicyclo[2.2.1]heptanyl]-2-(methoxycarbonylamino)acetate |
| SMILES | CCOC(=S)SC1[C@H]2CC[C@H](C2)[C@@H]1C(NC(=O)OC)C(=O)OC |
| InChI | InChI=1S/C15H23NO5S2/c1-4-21-15(22)23-12-9-6-5-8(7-9)10(12)11(13(17)19-2)16-14(18)20-3/h8-12H,4-7H2,1-3H3,(H,16,18)/t8-,9+,10-,11?,12?/m1/s1 |
| InChIKey | KCIALBOAIWWMLR-CFMPPFMSSA-N |
| XLogP | 2.35 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|