C15H22O7S2 — CID 15530646
cis-dimethyl (2S,3R)-2-ethoxycarbothioylsulfanyl-3-(2-ethoxy-2-oxoethyl)cyclobutane-1,1-dicarboxylate (PubChem CID 15530646) has the molecular formula C15H22O7S2 and a molecular weight of 378.47 g/mol. Its IUPAC name is cis-dimethyl (2S,3R)-2-ethoxycarbothioylsulfanyl-3-(2-ethoxy-2-oxoethyl)cyclobutane-1,1-dicarboxylate.
| Compound Name | cis-dimethyl (2S,3R)-2-ethoxycarbothioylsulfanyl-3-(2-ethoxy-2-oxoethyl)cyclobutane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 15530646 |
| Molecular Formula | C15H22O7S2 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | cis-dimethyl (2S,3R)-2-ethoxycarbothioylsulfanyl-3-(2-ethoxy-2-oxoethyl)cyclobutane-1,1-dicarboxylate |
| SMILES | CCOC(=O)C[C@H]1CC(C(=O)OC)(C(=O)OC)[C@H]1SC(=S)OCC |
| InChI | InChI=1S/C15H22O7S2/c1-5-21-10(16)7-9-8-15(12(17)19-3,13(18)20-4)11(9)24-14(23)22-6-2/h9,11H,5-8H2,1-4H3/t9-,11-/m0/s1 |
| InChIKey | MDVUBNAIALBVJQ-ONGXEEELSA-N |
| XLogP | 1.72 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|