C18H28O5S2 — CID 10927219
diethyl (3R,3aR,6aS)-3-(ethoxycarbothioylsulfanylmethyl)-3,3a,4,5,6,6a-hexahydro-2H-pentalene-1,1-dicarboxylate (PubChem CID 10927219) has the molecular formula C18H28O5S2 and a molecular weight of 388.55 g/mol. Its IUPAC name is diethyl (3R,3aR,6aS)-3-(ethoxycarbothioylsulfanylmethyl)-3,3a,4,5,6,6a-hexahydro-2H-pentalene-1,1-dicarboxylate.
| Compound Name | diethyl (3R,3aR,6aS)-3-(ethoxycarbothioylsulfanylmethyl)-3,3a,4,5,6,6a-hexahydro-2H-pentalene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 10927219 |
| Molecular Formula | C18H28O5S2 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | diethyl (3R,3aR,6aS)-3-(ethoxycarbothioylsulfanylmethyl)-3,3a,4,5,6,6a-hexahydro-2H-pentalene-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C[C@@H](CSC(=S)OCC)[C@@H]2CCC[C@@H]21 |
| InChI | InChI=1S/C18H28O5S2/c1-4-21-15(19)18(16(20)22-5-2)10-12(11-25-17(24)23-6-3)13-8-7-9-14(13)18/h12-14H,4-11H2,1-3H3/t12-,13-,14-/m0/s1 |
| InChIKey | WGBICRIOGOTJHT-IHRRRGAJSA-N |
| XLogP | 3.59 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|