C16H22O6S2 — CID 101084618
trans-dimethyl (2R,3R)-3-(2-cyclopropyl-2-oxoethyl)-2-ethoxycarbothioylsulfanylcyclobutane-1,1-dicarboxylate (PubChem CID 101084618) has the molecular formula C16H22O6S2 and a molecular weight of 374.48 g/mol. Its IUPAC name is trans-dimethyl (2R,3R)-3-(2-cyclopropyl-2-oxoethyl)-2-ethoxycarbothioylsulfanylcyclobutane-1,1-dicarboxylate.
| Compound Name | trans-dimethyl (2R,3R)-3-(2-cyclopropyl-2-oxoethyl)-2-ethoxycarbothioylsulfanylcyclobutane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 101084618 |
| Molecular Formula | C16H22O6S2 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | trans-dimethyl (2R,3R)-3-(2-cyclopropyl-2-oxoethyl)-2-ethoxycarbothioylsulfanylcyclobutane-1,1-dicarboxylate |
| SMILES | CCOC(=S)S[C@@H]1[C@@H](CC(=O)C2CC2)CC1(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C16H22O6S2/c1-4-22-15(23)24-12-10(7-11(17)9-5-6-9)8-16(12,13(18)20-2)14(19)21-3/h9-10,12H,4-8H2,1-3H3/t10-,12+/m0/s1 |
| InChIKey | QYAKDKGYPBQAIY-CMPLNLGQSA-N |
| XLogP | 2.13 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|