C16H26O4 — CID 177394180
dimethyl (3S,3aR,7aR)-3-propyl-2,3,3a,4,5,6,7,7a-octahydroindene-1,1-dicarboxylate (PubChem CID 177394180) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is dimethyl (3S,3aR,7aR)-3-propyl-2,3,3a,4,5,6,7,7a-octahydroindene-1,1-dicarboxylate.
| Compound Name | dimethyl (3S,3aR,7aR)-3-propyl-2,3,3a,4,5,6,7,7a-octahydroindene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 177394180 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | dimethyl (3S,3aR,7aR)-3-propyl-2,3,3a,4,5,6,7,7a-octahydroindene-1,1-dicarboxylate |
| SMILES | CCC[C@H]1CC(C(=O)OC)(C(=O)OC)[C@@H]2CCCC[C@H]12 |
| InChI | InChI=1S/C16H26O4/c1-4-7-11-10-16(14(17)19-2,15(18)20-3)13-9-6-5-8-12(11)13/h11-13H,4-10H2,1-3H3/t11-,12+,13+/m0/s1 |
| InChIKey | YUZRFLFOEIERGF-YNEHKIRRSA-N |
| XLogP | 2.95 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|