C11H22N2O2 — CID 97027382
1-methoxy-3-[(1S,2R)-2-propylcyclohexyl]urea (PubChem CID 97027382) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 1-methoxy-3-[(1S,2R)-2-propylcyclohexyl]urea.
| Compound Name | 1-methoxy-3-[(1S,2R)-2-propylcyclohexyl]urea |
|---|---|
| PubChem CID | 97027382 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 1-methoxy-3-[(1S,2R)-2-propylcyclohexyl]urea |
| SMILES | CCC[C@@H]1CCCC[C@@H]1NC(=O)NOC |
| InChI | InChI=1S/C11H22N2O2/c1-3-6-9-7-4-5-8-10(9)12-11(14)13-15-2/h9-10H,3-8H2,1-2H3,(H2,12,13,14)/t9-,10+/m1/s1 |
| InChIKey | OYRZZYUUWOKQAM-ZJUUUORDSA-N |
| XLogP | 2.21 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|