C14H27NO2 — CID 97027372
(2R)-2-ethoxy-N-[(1R,2R)-2-propylcyclohexyl]propanamide (PubChem CID 97027372) has the molecular formula C14H27NO2 and a molecular weight of 241.37 g/mol. Its IUPAC name is (2R)-2-ethoxy-N-[(1R,2R)-2-propylcyclohexyl]propanamide.
| Compound Name | (2R)-2-ethoxy-N-[(1R,2R)-2-propylcyclohexyl]propanamide |
|---|---|
| PubChem CID | 97027372 |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | (2R)-2-ethoxy-N-[(1R,2R)-2-propylcyclohexyl]propanamide |
| SMILES | CCC[C@@H]1CCCC[C@H]1NC(=O)[C@@H](C)OCC |
| InChI | InChI=1S/C14H27NO2/c1-4-8-12-9-6-7-10-13(12)15-14(16)11(3)17-5-2/h11-13H,4-10H2,1-3H3,(H,15,16)/t11-,12-,13-/m1/s1 |
| InChIKey | YTWLYZARXLUWAX-JHJVBQTASA-N |
| XLogP | 2.89 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |