C16H28O5 — CID 81305417
diethyl 2-(1-hydroxy-2,4,4-trimethylcyclohexyl)propanedioate (PubChem CID 81305417) has the molecular formula C16H28O5 and a molecular weight of 300.40 g/mol. Its IUPAC name is diethyl 2-(1-hydroxy-2,4,4-trimethylcyclohexyl)propanedioate.
| Compound Name | diethyl 2-(1-hydroxy-2,4,4-trimethylcyclohexyl)propanedioate |
|---|---|
| PubChem CID | 81305417 |
| Molecular Formula | C16H28O5 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | diethyl 2-(1-hydroxy-2,4,4-trimethylcyclohexyl)propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)C1(O)CCC(C)(C)CC1C |
| InChI | InChI=1S/C16H28O5/c1-6-20-13(17)12(14(18)21-7-2)16(19)9-8-15(4,5)10-11(16)3/h11-12,19H,6-10H2,1-5H3 |
| InChIKey | SZEPAXGLZWRVLD-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|