About ethyl 2-[1-(dimethylamino)-2,4,4-trimethylcyclohexyl]acetate
ethyl 2-[1-(dimethylamino)-2,4,4-trimethylcyclohexyl]acetate (PubChem CID 81315503) has the molecular formula C15H29NO2
and a molecular weight of 255.40 g/mol. Its IUPAC name is ethyl 2-[1-(dimethylamino)-2,4,4-trimethylcyclohexyl]acetate.
Analyze ethyl 2-[1-(dimethylamino)-2,4,4-trimethylcyclohexyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[1-(dimethylamino)-2,4,4-trimethylcyclohexyl]acetate?
The IUPAC name of ethyl 2-[1-(dimethylamino)-2,4,4-trimethylcyclohexyl]acetate (CID 81315503) is ethyl 2-[1-(dimethylamino)-2,4,4-trimethylcyclohexyl]acetate.
What is the SMILES notation for ethyl 2-[1-(dimethylamino)-2,4,4-trimethylcyclohexyl]acetate?
The canonical SMILES for ethyl 2-[1-(dimethylamino)-2,4,4-trimethylcyclohexyl]acetate is CCOC(=O)CC1(N(C)C)CCC(C)(C)CC1C.
What is the InChIKey of ethyl 2-[1-(dimethylamino)-2,4,4-trimethylcyclohexyl]acetate?
The InChIKey is BKSMARZTSRRSRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29NO2/c1-7-18-13(17)11-15(16(5)6)9-8-14(3,4)10-12(15)2/h12H,7-11H2,1-6H3.
What are the key properties of ethyl 2-[1-(dimethylamino)-2,4,4-trimethylcyclohexyl]acetate?
ethyl 2-[1-(dimethylamino)-2,4,4-trimethylcyclohexyl]acetate has a molecular weight of 255.40 g/mol, XLogP of 3.09, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[1-(dimethylamino)-2,4,4-trimethylcyclohexyl]acetate is sourced from PubChem (CID 81315503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).