About ethyl 2-(2,4,4-trimethyl-1-morpholin-4-ylcyclopentyl)acetate
ethyl 2-(2,4,4-trimethyl-1-morpholin-4-ylcyclopentyl)acetate (PubChem CID 106664180) has the molecular formula C16H29NO3
and a molecular weight of 283.41 g/mol. Its IUPAC name is ethyl 2-(2,4,4-trimethyl-1-morpholin-4-ylcyclopentyl)acetate.
Analyze ethyl 2-(2,4,4-trimethyl-1-morpholin-4-ylcyclopentyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(2,4,4-trimethyl-1-morpholin-4-ylcyclopentyl)acetate?
The IUPAC name of ethyl 2-(2,4,4-trimethyl-1-morpholin-4-ylcyclopentyl)acetate (CID 106664180) is ethyl 2-(2,4,4-trimethyl-1-morpholin-4-ylcyclopentyl)acetate.
What is the SMILES notation for ethyl 2-(2,4,4-trimethyl-1-morpholin-4-ylcyclopentyl)acetate?
The canonical SMILES for ethyl 2-(2,4,4-trimethyl-1-morpholin-4-ylcyclopentyl)acetate is CCOC(=O)CC1(N2CCOCC2)CC(C)(C)CC1C.
What is the InChIKey of ethyl 2-(2,4,4-trimethyl-1-morpholin-4-ylcyclopentyl)acetate?
The InChIKey is AIVRZILIINBDDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29NO3/c1-5-20-14(18)11-16(17-6-8-19-9-7-17)12-15(3,4)10-13(16)2/h13H,5-12H2,1-4H3.
What are the key properties of ethyl 2-(2,4,4-trimethyl-1-morpholin-4-ylcyclopentyl)acetate?
ethyl 2-(2,4,4-trimethyl-1-morpholin-4-ylcyclopentyl)acetate has a molecular weight of 283.41 g/mol, XLogP of 2.47, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(2,4,4-trimethyl-1-morpholin-4-ylcyclopentyl)acetate is sourced from PubChem (CID 106664180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).