About ethyl 2-(2,4,4-trimethyl-1-piperidin-1-ylcyclopentyl)acetate
ethyl 2-(2,4,4-trimethyl-1-piperidin-1-ylcyclopentyl)acetate (PubChem CID 106664184) has the molecular formula C17H31NO2
and a molecular weight of 281.44 g/mol. Its IUPAC name is ethyl 2-(2,4,4-trimethyl-1-piperidin-1-ylcyclopentyl)acetate.
Analyze ethyl 2-(2,4,4-trimethyl-1-piperidin-1-ylcyclopentyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(2,4,4-trimethyl-1-piperidin-1-ylcyclopentyl)acetate?
The IUPAC name of ethyl 2-(2,4,4-trimethyl-1-piperidin-1-ylcyclopentyl)acetate (CID 106664184) is ethyl 2-(2,4,4-trimethyl-1-piperidin-1-ylcyclopentyl)acetate.
What is the SMILES notation for ethyl 2-(2,4,4-trimethyl-1-piperidin-1-ylcyclopentyl)acetate?
The canonical SMILES for ethyl 2-(2,4,4-trimethyl-1-piperidin-1-ylcyclopentyl)acetate is CCOC(=O)CC1(N2CCCCC2)CC(C)(C)CC1C.
What is the InChIKey of ethyl 2-(2,4,4-trimethyl-1-piperidin-1-ylcyclopentyl)acetate?
The InChIKey is RESCYYNVNJSOBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H31NO2/c1-5-20-15(19)12-17(18-9-7-6-8-10-18)13-16(3,4)11-14(17)2/h14H,5-13H2,1-4H3.
What are the key properties of ethyl 2-(2,4,4-trimethyl-1-piperidin-1-ylcyclopentyl)acetate?
ethyl 2-(2,4,4-trimethyl-1-piperidin-1-ylcyclopentyl)acetate has a molecular weight of 281.44 g/mol, XLogP of 3.62, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(2,4,4-trimethyl-1-piperidin-1-ylcyclopentyl)acetate is sourced from PubChem (CID 106664184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).