C14H28O — CID 81313623
2,4,4-trimethyl-1-pentan-3-ylcyclohexan-1-ol (PubChem CID 81313623) has the molecular formula C14H28O and a molecular weight of 212.38 g/mol. Its IUPAC name is 2,4,4-trimethyl-1-pentan-3-ylcyclohexan-1-ol.
| Compound Name | 2,4,4-trimethyl-1-pentan-3-ylcyclohexan-1-ol |
|---|---|
| PubChem CID | 81313623 |
| Molecular Formula | C14H28O |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.21 |
| IUPAC Name | 2,4,4-trimethyl-1-pentan-3-ylcyclohexan-1-ol |
| SMILES | CCC(CC)C1(O)CCC(C)(C)CC1C |
| InChI | InChI=1S/C14H28O/c1-6-12(7-2)14(15)9-8-13(4,5)10-11(14)3/h11-12,15H,6-10H2,1-5H3 |
| InChIKey | WLDHMCHJHFNSHO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |