C13H23NO — CID 106664445
2-(1-hydroxy-2,4,4-trimethylcyclopentyl)pentanenitrile (PubChem CID 106664445) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is 2-(1-hydroxy-2,4,4-trimethylcyclopentyl)pentanenitrile.
| Compound Name | 2-(1-hydroxy-2,4,4-trimethylcyclopentyl)pentanenitrile |
|---|---|
| PubChem CID | 106664445 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 2-(1-hydroxy-2,4,4-trimethylcyclopentyl)pentanenitrile |
| SMILES | CCCC(C#N)C1(O)CC(C)(C)CC1C |
| InChI | InChI=1S/C13H23NO/c1-5-6-11(8-14)13(15)9-12(3,4)7-10(13)2/h10-11,15H,5-7,9H2,1-4H3 |
| InChIKey | YOLOPWTWRKUQGJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |