C28H42O7S2 — CID 101387507
diethyl 2-[3-[(3aS,7aS)-2-acetyloxy-7-ethoxycarbothioylsulfanyl-3a,5,5-trimethyl-2,3,4,6,7,7a-hexahydroinden-1-ylidene]-2-methylprop-2-enyl]propanedioate (PubChem CID 101387507) has the molecular formula C28H42O7S2 and a molecular weight of 554.77 g/mol. Its IUPAC name is diethyl 2-[3-[(3aS,7aS)-2-acetyloxy-7-ethoxycarbothioylsulfanyl-3a,5,5-trimethyl-2,3,4,6,7,7a-hexahydroinden-1-ylidene]-2-methylprop-2-enyl]propanedioate.
| Compound Name | diethyl 2-[3-[(3aS,7aS)-2-acetyloxy-7-ethoxycarbothioylsulfanyl-3a,5,5-trimethyl-2,3,4,6,7,7a-hexahydroinden-1-ylidene]-2-methylprop-2-enyl]propanedioate |
|---|---|
| PubChem CID | 101387507 |
| Molecular Formula | C28H42O7S2 |
| Molecular Weight | 554.77 g/mol |
| Exact Mass | 554.24 |
| IUPAC Name | diethyl 2-[3-[(3aS,7aS)-2-acetyloxy-7-ethoxycarbothioylsulfanyl-3a,5,5-trimethyl-2,3,4,6,7,7a-hexahydroinden-1-ylidene]-2-methylprop-2-enyl]propanedioate |
| SMILES | CCOC(=O)C(CC(C)=C=C1C(OC(C)=O)C[C@]2(C)CC(C)(C)CC(SC(=S)OCC)[C@H]12)C(=O)OCC |
| InChI | InChI=1S/C28H42O7S2/c1-9-32-24(30)20(25(31)33-10-2)13-17(4)12-19-21(35-18(5)29)14-28(8)16-27(6,7)15-22(23(19)28)37-26(36)34-11-3/h20-23H,9-11,13-16H2,1-8H3/t12?,21?,22?,23-,28+/m0/s1 |
| InChIKey | GLOPOBMNOOEUFQ-AYNJCBLUSA-N |
| XLogP | 5.79 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.77 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|