C23H34O4S2 — CID 101387524
[(3aS,7aS)-4-ethoxycarbothioylsulfanyl-6,6,7a-trimethyl-3-(5-oxohex-1-enylidene)-1,2,3a,4,5,7-hexahydroinden-2-yl] acetate (PubChem CID 101387524) has the molecular formula C23H34O4S2 and a molecular weight of 438.66 g/mol. Its IUPAC name is [(3aS,7aS)-4-ethoxycarbothioylsulfanyl-6,6,7a-trimethyl-3-(5-oxohex-1-enylidene)-1,2,3a,4,5,7-hexahydroinden-2-yl] acetate.
| Compound Name | [(3aS,7aS)-4-ethoxycarbothioylsulfanyl-6,6,7a-trimethyl-3-(5-oxohex-1-enylidene)-1,2,3a,4,5,7-hexahydroinden-2-yl] acetate |
|---|---|
| PubChem CID | 101387524 |
| Molecular Formula | C23H34O4S2 |
| Molecular Weight | 438.66 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | [(3aS,7aS)-4-ethoxycarbothioylsulfanyl-6,6,7a-trimethyl-3-(5-oxohex-1-enylidene)-1,2,3a,4,5,7-hexahydroinden-2-yl] acetate |
| SMILES | CCOC(=S)SC1CC(C)(C)C[C@@]2(C)CC(OC(C)=O)C(=C=CCCC(C)=O)[C@@H]12 |
| InChI | InChI=1S/C23H34O4S2/c1-7-26-21(28)29-19-13-22(4,5)14-23(6)12-18(27-16(3)25)17(20(19)23)11-9-8-10-15(2)24/h9,18-20H,7-8,10,12-14H2,1-6H3/t11?,18?,19?,20-,23+/m0/s1 |
| InChIKey | ACTIVKGGINHVIA-APAINTLYSA-N |
| XLogP | 5.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.66 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|