C23H34O3 — CID 10522418
ethyl (4S,4aS,7Z,8Z)-4,10a-dimethyl-7-(4-methylpent-4-enylidene)-3-oxo-1,2,4a,5,6,10-hexahydrobenzo[8]annulene-4-carboxylate (PubChem CID 10522418) has the molecular formula C23H34O3 and a molecular weight of 358.52 g/mol. Its IUPAC name is ethyl (4S,4aS,7Z,8Z)-4,10a-dimethyl-7-(4-methylpent-4-enylidene)-3-oxo-1,2,4a,5,6,10-hexahydrobenzo[8]annulene-4-carboxylate.
| Compound Name | ethyl (4S,4aS,7Z,8Z)-4,10a-dimethyl-7-(4-methylpent-4-enylidene)-3-oxo-1,2,4a,5,6,10-hexahydrobenzo[8]annulene-4-carboxylate |
|---|---|
| PubChem CID | 10522418 |
| Molecular Formula | C23H34O3 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | ethyl (4S,4aS,7Z,8Z)-4,10a-dimethyl-7-(4-methylpent-4-enylidene)-3-oxo-1,2,4a,5,6,10-hexahydrobenzo[8]annulene-4-carboxylate |
| SMILES | C=C(C)CC/C=C1\C=C/CC2(C)CCC(=O)[C@@](C)(C(=O)OCC)[C@H]2CC1 |
| InChI | InChI=1S/C23H34O3/c1-6-26-21(25)23(5)19-13-12-18(10-7-9-17(2)3)11-8-15-22(19,4)16-14-20(23)24/h8,10-11,19H,2,6-7,9,12-16H2,1,3-5H3/b11-8-,18-10+/t19-,22?,23-/m0/s1 |
| InChIKey | QHVWEAWLWBKMBH-KHPMNLOMSA-N |
| XLogP | 5.56 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|