C19H26O5 — CID 101221046
ethyl (1R)-1-[(3aS,5R,7aS)-3a-hydroxy-7a-methyl-1-oxo-2,3,4,5,6,7-hexahydroinden-5-yl]-4-oxocyclohex-2-ene-1-carboxylate (PubChem CID 101221046) has the molecular formula C19H26O5 and a molecular weight of 334.41 g/mol. Its IUPAC name is ethyl (1R)-1-[(3aS,5R,7aS)-3a-hydroxy-7a-methyl-1-oxo-2,3,4,5,6,7-hexahydroinden-5-yl]-4-oxocyclohex-2-ene-1-carboxylate.
| Compound Name | ethyl (1R)-1-[(3aS,5R,7aS)-3a-hydroxy-7a-methyl-1-oxo-2,3,4,5,6,7-hexahydroinden-5-yl]-4-oxocyclohex-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 101221046 |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | ethyl (1R)-1-[(3aS,5R,7aS)-3a-hydroxy-7a-methyl-1-oxo-2,3,4,5,6,7-hexahydroinden-5-yl]-4-oxocyclohex-2-ene-1-carboxylate |
| SMILES | CCOC(=O)[C@]1([C@@H]2CC[C@]3(C)C(=O)CC[C@]3(O)C2)C=CC(=O)CC1 |
| InChI | InChI=1S/C19H26O5/c1-3-24-16(22)18(9-5-14(20)6-10-18)13-4-8-17(2)15(21)7-11-19(17,23)12-13/h5,9,13,23H,3-4,6-8,10-12H2,1-2H3/t13-,17-,18-,19+/m1/s1 |
| InChIKey | SENPPHJGTKMALE-XEKGUZQTSA-N |
| XLogP | 2.36 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |