C10H15BrO2 — CID 10377283
(3aS,5R,7aS)-5-bromo-3a-hydroxy-7a-methyl-2,3,4,5,6,7-hexahydroinden-1-one (PubChem CID 10377283) has the molecular formula C10H15BrO2 and a molecular weight of 247.13 g/mol. Its IUPAC name is (3aS,5R,7aS)-5-bromo-3a-hydroxy-7a-methyl-2,3,4,5,6,7-hexahydroinden-1-one.
| Compound Name | (3aS,5R,7aS)-5-bromo-3a-hydroxy-7a-methyl-2,3,4,5,6,7-hexahydroinden-1-one |
|---|---|
| PubChem CID | 10377283 |
| Molecular Formula | C10H15BrO2 |
| Molecular Weight | 247.13 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | (3aS,5R,7aS)-5-bromo-3a-hydroxy-7a-methyl-2,3,4,5,6,7-hexahydroinden-1-one |
| SMILES | C[C@]12CC[C@@H](Br)C[C@@]1(O)CCC2=O |
| InChI | InChI=1S/C10H15BrO2/c1-9-4-2-7(11)6-10(9,13)5-3-8(9)12/h7,13H,2-6H2,1H3/t7-,9-,10+/m1/s1 |
| InChIKey | CBVMHCPELPHYLC-QNSHHTMESA-N |
| XLogP | 2.03 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.13 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|