C9H16O2 — CID 10920759
cis-(3S,4R)-2-hydroxy-2,3,4-trimethylcyclohexan-1-one (PubChem CID 10920759) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is cis-(3S,4R)-2-hydroxy-2,3,4-trimethylcyclohexan-1-one.
| Compound Name | cis-(3S,4R)-2-hydroxy-2,3,4-trimethylcyclohexan-1-one |
|---|---|
| PubChem CID | 10920759 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | cis-(3S,4R)-2-hydroxy-2,3,4-trimethylcyclohexan-1-one |
| SMILES | C[C@@H]1CCC(=O)C(C)(O)[C@H]1C |
| InChI | InChI=1S/C9H16O2/c1-6-4-5-8(10)9(3,11)7(6)2/h6-7,11H,4-5H2,1-3H3/t6-,7+,9?/m1/s1 |
| InChIKey | XXXVTDLPPAZBOX-CSTAXXSYSA-N |
| XLogP | 1.37 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |