C12H23NO — CID 163712955
(1R)-2-amino-1,4,5-trimethyl-8-methylidenecyclooctan-1-ol (PubChem CID 163712955) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is (1R)-2-amino-1,4,5-trimethyl-8-methylidenecyclooctan-1-ol.
| Compound Name | (1R)-2-amino-1,4,5-trimethyl-8-methylidenecyclooctan-1-ol |
|---|---|
| PubChem CID | 163712955 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | (1R)-2-amino-1,4,5-trimethyl-8-methylidenecyclooctan-1-ol |
| SMILES | C=C1CCC(C)C(C)CC(N)[C@]1(C)O |
| InChI | InChI=1S/C12H23NO/c1-8-5-6-10(3)12(4,14)11(13)7-9(8)2/h8-9,11,14H,3,5-7,13H2,1-2,4H3/t8?,9?,11?,12-/m1/s1 |
| InChIKey | KKWKOVMGHRACTC-HYHRHQCWSA-N |
| XLogP | 2.08 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|