C11H15BrO3 — CID 100934720
(3aR,4S,6E,7aS)-6-(bromomethylidene)-3a,4-dihydroxy-7a-methyl-3,4,5,7-tetrahydro-2H-inden-1-one (PubChem CID 100934720) has the molecular formula C11H15BrO3 and a molecular weight of 275.14 g/mol. Its IUPAC name is (3aR,4S,6E,7aS)-6-(bromomethylidene)-3a,4-dihydroxy-7a-methyl-3,4,5,7-tetrahydro-2H-inden-1-one.
| Compound Name | (3aR,4S,6E,7aS)-6-(bromomethylidene)-3a,4-dihydroxy-7a-methyl-3,4,5,7-tetrahydro-2H-inden-1-one |
|---|---|
| PubChem CID | 100934720 |
| Molecular Formula | C11H15BrO3 |
| Molecular Weight | 275.14 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | (3aR,4S,6E,7aS)-6-(bromomethylidene)-3a,4-dihydroxy-7a-methyl-3,4,5,7-tetrahydro-2H-inden-1-one |
| SMILES | C[C@]12C/C(=C\Br)C[C@H](O)[C@@]1(O)CCC2=O |
| InChI | InChI=1S/C11H15BrO3/c1-10-5-7(6-12)4-9(14)11(10,15)3-2-8(10)13/h6,9,14-15H,2-5H2,1H3/b7-6-/t9-,10+,11-/m0/s1 |
| InChIKey | IAAULBKGPRQGHZ-OSTGGIHBSA-N |
| XLogP | 1.52 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.14 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |