C18H22O3 — CID 15377734
(3aR,4S,8aR)-3a,4-dihydroxy-8a-methyl-7-(4-methylphenyl)-3,4,5,8-tetrahydro-2H-azulen-1-one (PubChem CID 15377734) has the molecular formula C18H22O3 and a molecular weight of 286.37 g/mol. Its IUPAC name is (3aR,4S,8aR)-3a,4-dihydroxy-8a-methyl-7-(4-methylphenyl)-3,4,5,8-tetrahydro-2H-azulen-1-one.
| Compound Name | (3aR,4S,8aR)-3a,4-dihydroxy-8a-methyl-7-(4-methylphenyl)-3,4,5,8-tetrahydro-2H-azulen-1-one |
|---|---|
| PubChem CID | 15377734 |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | (3aR,4S,8aR)-3a,4-dihydroxy-8a-methyl-7-(4-methylphenyl)-3,4,5,8-tetrahydro-2H-azulen-1-one |
| SMILES | Cc1ccc(C2=CC[C@H](O)[C@@]3(O)CCC(=O)[C@]3(C)C2)cc1 |
| InChI | InChI=1S/C18H22O3/c1-12-3-5-13(6-4-12)14-7-8-16(20)18(21)10-9-15(19)17(18,2)11-14/h3-7,16,20-21H,8-11H2,1-2H3/t16-,17-,18-/m0/s1 |
| InChIKey | IOJVEDBPFLNPLY-BZSNNMDCSA-N |
| XLogP | 2.63 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |