C16H20O — CID 10823255
(4aS,8aS)-6-phenyl-2,3,4,5,8,8a-hexahydro-1H-naphthalen-4a-ol (PubChem CID 10823255) has the molecular formula C16H20O and a molecular weight of 228.34 g/mol. Its IUPAC name is (4aS,8aS)-6-phenyl-2,3,4,5,8,8a-hexahydro-1H-naphthalen-4a-ol.
| Compound Name | (4aS,8aS)-6-phenyl-2,3,4,5,8,8a-hexahydro-1H-naphthalen-4a-ol |
|---|---|
| PubChem CID | 10823255 |
| Molecular Formula | C16H20O |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | (4aS,8aS)-6-phenyl-2,3,4,5,8,8a-hexahydro-1H-naphthalen-4a-ol |
| SMILES | O[C@]12CCCC[C@H]1CC=C(c1ccccc1)C2 |
| InChI | InChI=1S/C16H20O/c17-16-11-5-4-8-15(16)10-9-14(12-16)13-6-2-1-3-7-13/h1-3,6-7,9,15,17H,4-5,8,10-12H2/t15-,16-/m0/s1 |
| InChIKey | YSCNSZDFIYVGFW-HOTGVXAUSA-N |
| XLogP | 3.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |