C16H22 — CID 611743
8a-phenyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalene (PubChem CID 611743) has the molecular formula C16H22 and a molecular weight of 214.35 g/mol. Its IUPAC name is 8a-phenyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalene.
| Compound Name | 8a-phenyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalene |
|---|---|
| PubChem CID | 611743 |
| Molecular Formula | C16H22 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 8a-phenyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalene |
| SMILES | c1ccc(C23CCCCC2CCCC3)cc1 |
| InChI | InChI=1S/C16H22/c1-2-8-14(9-3-1)16-12-6-4-10-15(16)11-5-7-13-16/h1-3,8-9,15H,4-7,10-13H2 |
| InChIKey | ZHMLKBNVMRHEEY-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |