C18H23N — CID 22807523
(4aS,8aR)-4a-phenyl-2-prop-2-ynyl-1,3,4,5,6,7,8,8a-octahydroisoquinoline (PubChem CID 22807523) has the molecular formula C18H23N and a molecular weight of 253.39 g/mol. Its IUPAC name is (4aS,8aR)-4a-phenyl-2-prop-2-ynyl-1,3,4,5,6,7,8,8a-octahydroisoquinoline.
| Compound Name | (4aS,8aR)-4a-phenyl-2-prop-2-ynyl-1,3,4,5,6,7,8,8a-octahydroisoquinoline |
|---|---|
| PubChem CID | 22807523 |
| Molecular Formula | C18H23N |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | (4aS,8aR)-4a-phenyl-2-prop-2-ynyl-1,3,4,5,6,7,8,8a-octahydroisoquinoline |
| SMILES | C#CCN1CC[C@@]2(c3ccccc3)CCCC[C@H]2C1 |
| InChI | InChI=1S/C18H23N/c1-2-13-19-14-12-18(16-8-4-3-5-9-16)11-7-6-10-17(18)15-19/h1,3-5,8-9,17H,6-7,10-15H2/t17-,18+/m0/s1 |
| InChIKey | FTBSXKJLYWZEPA-ZWKOTPCHSA-N |
| XLogP | 3.45 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|