C23H30ClNO4S — CID 173433412
2-(4a-phenyl-3,4,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-2-yl)-1-(4-chlorophenyl)ethanol;methanesulfonic acid (PubChem CID 173433412) has the molecular formula C23H30ClNO4S and a molecular weight of 452.02 g/mol. Its IUPAC name is 2-(4a-phenyl-3,4,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-2-yl)-1-(4-chlorophenyl)ethanol;methanesulfonic acid.
| Compound Name | 2-(4a-phenyl-3,4,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-2-yl)-1-(4-chlorophenyl)ethanol;methanesulfonic acid |
|---|---|
| PubChem CID | 173433412 |
| Molecular Formula | C23H30ClNO4S |
| Molecular Weight | 452.02 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | 2-(4a-phenyl-3,4,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-2-yl)-1-(4-chlorophenyl)ethanol;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.OC(CN1CCC2(c3ccccc3)CCCC2C1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H26ClNO.CH4O3S/c23-20-10-8-17(9-11-20)21(25)16-24-14-13-22(12-4-7-19(22)15-24)18-5-2-1-3-6-18;1-5(2,3)4/h1-3,5-6,8-11,19,21,25H,4,7,12-16H2;1H3,(H,2,3,4) |
| InChIKey | PQHLVMZVEDAXAZ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.02 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|