C15H18O2 — CID 11229978
(4aS,8aR)-2-phenyl-4,5,6,7,8,8a-hexahydrochromen-4a-ol (PubChem CID 11229978) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is (4aS,8aR)-2-phenyl-4,5,6,7,8,8a-hexahydrochromen-4a-ol.
| Compound Name | (4aS,8aR)-2-phenyl-4,5,6,7,8,8a-hexahydrochromen-4a-ol |
|---|---|
| PubChem CID | 11229978 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | (4aS,8aR)-2-phenyl-4,5,6,7,8,8a-hexahydrochromen-4a-ol |
| SMILES | O[C@@]12CC=C(c3ccccc3)O[C@@H]1CCCC2 |
| InChI | InChI=1S/C15H18O2/c16-15-10-5-4-8-14(15)17-13(9-11-15)12-6-2-1-3-7-12/h1-3,6-7,9,14,16H,4-5,8,10-11H2/t14-,15+/m1/s1 |
| InChIKey | UOOHIHVPLOBOOJ-CABCVRRESA-N |
| XLogP | 3.12 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |