C16H22O2 — CID 161091453
(4R,4aS,8aS)-4-benzyl-2,3,4,5,6,7,8,8a-octahydrochromen-4a-ol (PubChem CID 161091453) has the molecular formula C16H22O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is (4R,4aS,8aS)-4-benzyl-2,3,4,5,6,7,8,8a-octahydrochromen-4a-ol.
| Compound Name | (4R,4aS,8aS)-4-benzyl-2,3,4,5,6,7,8,8a-octahydrochromen-4a-ol |
|---|---|
| PubChem CID | 161091453 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | (4R,4aS,8aS)-4-benzyl-2,3,4,5,6,7,8,8a-octahydrochromen-4a-ol |
| SMILES | O[C@]12CCCC[C@@H]1OCC[C@H]2Cc1ccccc1 |
| InChI | InChI=1S/C16H22O2/c17-16-10-5-4-8-15(16)18-11-9-14(16)12-13-6-2-1-3-7-13/h1-3,6-7,14-15,17H,4-5,8-12H2/t14-,15-,16-/m0/s1 |
| InChIKey | UHFQTCORXFMUID-JYJNAYRXSA-N |
| XLogP | 2.94 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |