C38H42O2 — CID 101082629
(5aR,6R,7S,8S,9R)-6,7,8,9-tetrabenzyl-3,4,5,6,7,8,9,9a-octahydro-2H-benzo[b]oxepin-5a-ol (PubChem CID 101082629) has the molecular formula C38H42O2 and a molecular weight of 530.75 g/mol. Its IUPAC name is (5aR,6R,7S,8S,9R)-6,7,8,9-tetrabenzyl-3,4,5,6,7,8,9,9a-octahydro-2H-benzo[b]oxepin-5a-ol.
| Compound Name | (5aR,6R,7S,8S,9R)-6,7,8,9-tetrabenzyl-3,4,5,6,7,8,9,9a-octahydro-2H-benzo[b]oxepin-5a-ol |
|---|---|
| PubChem CID | 101082629 |
| Molecular Formula | C38H42O2 |
| Molecular Weight | 530.75 g/mol |
| Exact Mass | 530.32 |
| IUPAC Name | (5aR,6R,7S,8S,9R)-6,7,8,9-tetrabenzyl-3,4,5,6,7,8,9,9a-octahydro-2H-benzo[b]oxepin-5a-ol |
| SMILES | O[C@@]12CCCCOC1[C@H](Cc1ccccc1)[C@@H](Cc1ccccc1)[C@H](Cc1ccccc1)[C@H]2Cc1ccccc1 |
| InChI | InChI=1S/C38H42O2/c39-38-23-13-14-24-40-37(38)35(27-31-19-9-3-10-20-31)33(25-29-15-5-1-6-16-29)34(26-30-17-7-2-8-18-30)36(38)28-32-21-11-4-12-22-32/h1-12,15-22,33-37,39H,13-14,23-28H2/t33-,34-,35+,36+,37?,38+/m0/s1 |
| InChIKey | VGOJHMNXWWFYMS-UADYPDNCSA-N |
| XLogP | 7.74 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.75 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |