C20H22O4 — CID 70475095
(4-benzyl-1,3,5-trihydroxycyclohexyl)-phenylmethanone (PubChem CID 70475095) has the molecular formula C20H22O4 and a molecular weight of 326.39 g/mol. Its IUPAC name is (4-benzyl-1,3,5-trihydroxycyclohexyl)-phenylmethanone.
| Compound Name | (4-benzyl-1,3,5-trihydroxycyclohexyl)-phenylmethanone |
|---|---|
| PubChem CID | 70475095 |
| Molecular Formula | C20H22O4 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | (4-benzyl-1,3,5-trihydroxycyclohexyl)-phenylmethanone |
| SMILES | O=C(c1ccccc1)C1(O)CC(O)C(Cc2ccccc2)C(O)C1 |
| InChI | InChI=1S/C20H22O4/c21-17-12-20(24,19(23)15-9-5-2-6-10-15)13-18(22)16(17)11-14-7-3-1-4-8-14/h1-10,16-18,21-22,24H,11-13H2 |
| InChIKey | UWSFZKDNRYTSGQ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |