C14H16O6 — CID 46842300
(1R,2S,3R,4S)-2-benzyl-1,3,4-trihydroxy-5-oxocyclohexane-1-carboxylic acid (PubChem CID 46842300) has the molecular formula C14H16O6 and a molecular weight of 280.28 g/mol. Its IUPAC name is (1R,2S,3R,4S)-2-benzyl-1,3,4-trihydroxy-5-oxocyclohexane-1-carboxylic acid.
| Compound Name | (1R,2S,3R,4S)-2-benzyl-1,3,4-trihydroxy-5-oxocyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 46842300 |
| Molecular Formula | C14H16O6 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | (1R,2S,3R,4S)-2-benzyl-1,3,4-trihydroxy-5-oxocyclohexane-1-carboxylic acid |
| SMILES | O=C1C[C@](O)(C(=O)O)[C@@H](Cc2ccccc2)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H16O6/c15-10-7-14(20,13(18)19)9(11(16)12(10)17)6-8-4-2-1-3-5-8/h1-5,9,11-12,16-17,20H,6-7H2,(H,18,19)/t9-,11+,12+,14+/m0/s1 |
| InChIKey | BTDFSXSSEMVORE-LEJCRSTHSA-N |
| XLogP | -0.64 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |