C14H16O4 — CID 102419760
trans-(1R,3S)-3-benzyl-1-hydroxy-2-oxocyclohexane-1-carboxylic acid (PubChem CID 102419760) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is trans-(1R,3S)-3-benzyl-1-hydroxy-2-oxocyclohexane-1-carboxylic acid.
| Compound Name | trans-(1R,3S)-3-benzyl-1-hydroxy-2-oxocyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 102419760 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | trans-(1R,3S)-3-benzyl-1-hydroxy-2-oxocyclohexane-1-carboxylic acid |
| SMILES | O=C(O)[C@@]1(O)CCC[C@@H](Cc2ccccc2)C1=O |
| InChI | InChI=1S/C14H16O4/c15-12-11(9-10-5-2-1-3-6-10)7-4-8-14(12,18)13(16)17/h1-3,5-6,11,18H,4,7-9H2,(H,16,17)/t11-,14+/m0/s1 |
| InChIKey | GITZGWCGXAESBV-SMDDNHRTSA-N |
| XLogP | 1.41 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|