C14H16O3 — CID 102419759
trans-(1S,3S)-3-benzyl-2-oxocyclohexane-1-carboxylic acid (PubChem CID 102419759) has the molecular formula C14H16O3 and a molecular weight of 232.28 g/mol. Its IUPAC name is trans-(1S,3S)-3-benzyl-2-oxocyclohexane-1-carboxylic acid.
| Compound Name | trans-(1S,3S)-3-benzyl-2-oxocyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 102419759 |
| Molecular Formula | C14H16O3 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | trans-(1S,3S)-3-benzyl-2-oxocyclohexane-1-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCC[C@@H](Cc2ccccc2)C1=O |
| InChI | InChI=1S/C14H16O3/c15-13-11(7-4-8-12(13)14(16)17)9-10-5-2-1-3-6-10/h1-3,5-6,11-12H,4,7-9H2,(H,16,17)/t11-,12-/m0/s1 |
| InChIKey | YLWZYZUCFOFHMH-RYUDHWBXSA-N |
| XLogP | 2.30 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|