About trans-(2S,6S)-2-(2,2-dimethoxyacetyl)-6-(3-phenylpropyl)cyclohexan-1-one
trans-(2S,6S)-2-(2,2-dimethoxyacetyl)-6-(3-phenylpropyl)cyclohexan-1-one (PubChem CID 129404807) has the molecular formula C19H26O4
and a molecular weight of 318.41 g/mol. Its IUPAC name is trans-(2S,6S)-2-(2,2-dimethoxyacetyl)-6-(3-phenylpropyl)cyclohexan-1-one.
Molecular Properties
| Compound Name | trans-(2S,6S)-2-(2,2-dimethoxyacetyl)-6-(3-phenylpropyl)cyclohexan-1-one |
| PubChem CID | 129404807 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | trans-(2S,6S)-2-(2,2-dimethoxyacetyl)-6-(3-phenylpropyl)cyclohexan-1-one |
| SMILES | COC(OC)C(=O)[C@H]1CCC[C@@H](CCCc2ccccc2)C1=O |
| InChI | InChI=1S/C19H26O4/c1-22-19(23-2)18(21)16-13-7-12-15(17(16)20)11-6-10-14-8-4-3-5-9-14/h3-5,8-9,15-16,19H,6-7,10-13H2,1-2H3/t15-,16+/m1/s1 |
| InChIKey | PKGIMYRNJHTOPW-CVEARBPZSA-N |
| XLogP | 3.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze trans-(2S,6S)-2-(2,2-dimethoxyacetyl)-6-(3-phenylpropyl)cyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(2S,6S)-2-(2,2-dimethoxyacetyl)-6-(3-phenylpropyl)cyclohexan-1-one?
The IUPAC name of trans-(2S,6S)-2-(2,2-dimethoxyacetyl)-6-(3-phenylpropyl)cyclohexan-1-one (CID 129404807) is trans-(2S,6S)-2-(2,2-dimethoxyacetyl)-6-(3-phenylpropyl)cyclohexan-1-one.
What is the SMILES notation for trans-(2S,6S)-2-(2,2-dimethoxyacetyl)-6-(3-phenylpropyl)cyclohexan-1-one?
The canonical SMILES for trans-(2S,6S)-2-(2,2-dimethoxyacetyl)-6-(3-phenylpropyl)cyclohexan-1-one is COC(OC)C(=O)[C@H]1CCC[C@@H](CCCc2ccccc2)C1=O.
What is the InChIKey of trans-(2S,6S)-2-(2,2-dimethoxyacetyl)-6-(3-phenylpropyl)cyclohexan-1-one?
The InChIKey is PKGIMYRNJHTOPW-CVEARBPZSA-N. The full InChI is InChI=1S/C19H26O4/c1-22-19(23-2)18(21)16-13-7-12-15(17(16)20)11-6-10-14-8-4-3-5-9-14/h3-5,8-9,15-16,19H,6-7,10-13H2,1-2H3/t15-,16+/m1/s1.
What are the key properties of trans-(2S,6S)-2-(2,2-dimethoxyacetyl)-6-(3-phenylpropyl)cyclohexan-1-one?
trans-(2S,6S)-2-(2,2-dimethoxyacetyl)-6-(3-phenylpropyl)cyclohexan-1-one has a molecular weight of 318.41 g/mol, XLogP of 3.18, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(2S,6S)-2-(2,2-dimethoxyacetyl)-6-(3-phenylpropyl)cyclohexan-1-one is sourced from PubChem (CID 129404807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).