C19H26O4 — CID 129404805
cis-(2S,6R)-2-(2,2-dimethoxyacetyl)-6-(3-phenylpropyl)cyclohexan-1-one (PubChem CID 129404805) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is cis-(2S,6R)-2-(2,2-dimethoxyacetyl)-6-(3-phenylpropyl)cyclohexan-1-one.
| Compound Name | cis-(2S,6R)-2-(2,2-dimethoxyacetyl)-6-(3-phenylpropyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 129404805 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | cis-(2S,6R)-2-(2,2-dimethoxyacetyl)-6-(3-phenylpropyl)cyclohexan-1-one |
| SMILES | COC(OC)C(=O)[C@H]1CCC[C@H](CCCc2ccccc2)C1=O |
| InChI | InChI=1S/C19H26O4/c1-22-19(23-2)18(21)16-13-7-12-15(17(16)20)11-6-10-14-8-4-3-5-9-14/h3-5,8-9,15-16,19H,6-7,10-13H2,1-2H3/t15-,16-/m0/s1 |
| InChIKey | PKGIMYRNJHTOPW-HOTGVXAUSA-N |
| XLogP | 3.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|