C34H48OSi — CID 101393001
trans-(2R,6S)-2,6-dibenzyl-2-(2-tributylsilylethynyl)cyclohexan-1-one (PubChem CID 101393001) has the molecular formula C34H48OSi and a molecular weight of 500.84 g/mol. Its IUPAC name is trans-(2R,6S)-2,6-dibenzyl-2-(2-tributylsilylethynyl)cyclohexan-1-one.
| Compound Name | trans-(2R,6S)-2,6-dibenzyl-2-(2-tributylsilylethynyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 101393001 |
| Molecular Formula | C34H48OSi |
| Molecular Weight | 500.84 g/mol |
| Exact Mass | 500.35 |
| IUPAC Name | trans-(2R,6S)-2,6-dibenzyl-2-(2-tributylsilylethynyl)cyclohexan-1-one |
| SMILES | CCCC[Si](C#C[C@]1(Cc2ccccc2)CCC[C@@H](Cc2ccccc2)C1=O)(CCCC)CCCC |
| InChI | InChI=1S/C34H48OSi/c1-4-7-24-36(25-8-5-2,26-9-6-3)27-23-34(29-31-19-14-11-15-20-31)22-16-21-32(33(34)35)28-30-17-12-10-13-18-30/h10-15,17-20,32H,4-9,16,21-22,24-26,28-29H2,1-3H3/t32-,34-/m0/s1 |
| InChIKey | KSXNYQWVQHQMAG-TWJUONSBSA-N |
| XLogP | 9.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.84 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|