C17H20F2O3 — CID 150325553
3-benzyl-1-(difluoromethyl)-2-oxocyclooctane-1-carboxylic acid (PubChem CID 150325553) has the molecular formula C17H20F2O3 and a molecular weight of 310.34 g/mol. Its IUPAC name is 3-benzyl-1-(difluoromethyl)-2-oxocyclooctane-1-carboxylic acid.
| Compound Name | 3-benzyl-1-(difluoromethyl)-2-oxocyclooctane-1-carboxylic acid |
|---|---|
| PubChem CID | 150325553 |
| Molecular Formula | C17H20F2O3 |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 3-benzyl-1-(difluoromethyl)-2-oxocyclooctane-1-carboxylic acid |
| SMILES | O=C(O)C1(C(F)F)CCCCCC(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C17H20F2O3/c18-15(19)17(16(21)22)10-6-2-5-9-13(14(17)20)11-12-7-3-1-4-8-12/h1,3-4,7-8,13,15H,2,5-6,9-11H2,(H,21,22) |
| InChIKey | GOOHKTQIGDCCTD-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|