C17H20F2O3 — CID 174994677
benzyl 1-(difluoromethyl)-2-oxocyclooctane-1-carboxylate (PubChem CID 174994677) has the molecular formula C17H20F2O3 and a molecular weight of 310.34 g/mol. Its IUPAC name is benzyl 1-(difluoromethyl)-2-oxocyclooctane-1-carboxylate.
| Compound Name | benzyl 1-(difluoromethyl)-2-oxocyclooctane-1-carboxylate |
|---|---|
| PubChem CID | 174994677 |
| Molecular Formula | C17H20F2O3 |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | benzyl 1-(difluoromethyl)-2-oxocyclooctane-1-carboxylate |
| SMILES | O=C1CCCCCCC1(C(=O)OCc1ccccc1)C(F)F |
| InChI | InChI=1S/C17H20F2O3/c18-15(19)17(11-7-2-1-6-10-14(17)20)16(21)22-12-13-8-4-3-5-9-13/h3-5,8-9,15H,1-2,6-7,10-12H2 |
| InChIKey | PMROJEIJJSEGEA-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|