C24H27NO6 — CID 11962061
ethyl 1-[(4-methoxyphenyl)-(phenylmethoxycarbonylamino)methyl]-2-oxocyclopentane-1-carboxylate (PubChem CID 11962061) has the molecular formula C24H27NO6 and a molecular weight of 425.48 g/mol. Its IUPAC name is ethyl 1-[(4-methoxyphenyl)-(phenylmethoxycarbonylamino)methyl]-2-oxocyclopentane-1-carboxylate.
| Compound Name | ethyl 1-[(4-methoxyphenyl)-(phenylmethoxycarbonylamino)methyl]-2-oxocyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 11962061 |
| Molecular Formula | C24H27NO6 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | ethyl 1-[(4-methoxyphenyl)-(phenylmethoxycarbonylamino)methyl]-2-oxocyclopentane-1-carboxylate |
| SMILES | CCOC(=O)C1(C(NC(=O)OCc2ccccc2)c2ccc(OC)cc2)CCCC1=O |
| InChI | InChI=1S/C24H27NO6/c1-3-30-22(27)24(15-7-10-20(24)26)21(18-11-13-19(29-2)14-12-18)25-23(28)31-16-17-8-5-4-6-9-17/h4-6,8-9,11-14,21H,3,7,10,15-16H2,1-2H3,(H,25,28) |
| InChIKey | HCKPHBKXXOUDIX-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|