C18H20INO4 — CID 87810858
prop-2-enyl N-[(S)-[1-(2-iodoacetyl)-2-oxocyclopentyl]-phenylmethyl]carbamate (PubChem CID 87810858) has the molecular formula C18H20INO4 and a molecular weight of 441.27 g/mol. Its IUPAC name is prop-2-enyl N-[(S)-[1-(2-iodoacetyl)-2-oxocyclopentyl]-phenylmethyl]carbamate.
| Compound Name | prop-2-enyl N-[(S)-[1-(2-iodoacetyl)-2-oxocyclopentyl]-phenylmethyl]carbamate |
|---|---|
| PubChem CID | 87810858 |
| Molecular Formula | C18H20INO4 |
| Molecular Weight | 441.27 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | prop-2-enyl N-[(S)-[1-(2-iodoacetyl)-2-oxocyclopentyl]-phenylmethyl]carbamate |
| SMILES | C=CCOC(=O)N[C@@H](c1ccccc1)C1(C(=O)CI)CCCC1=O |
| InChI | InChI=1S/C18H20INO4/c1-2-11-24-17(23)20-16(13-7-4-3-5-8-13)18(15(22)12-19)10-6-9-14(18)21/h2-5,7-8,16H,1,6,9-12H2,(H,20,23)/t16-,18?/m0/s1 |
| InChIKey | BVARSCVHTIEZTI-ATNAJCNCSA-N |
| XLogP | 3.38 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.27 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|