C17H21NO4 — CID 16759010
methyl N-[[(1S)-1-acetyl-2-oxocyclopentyl]-(3-methylphenyl)methyl]carbamate (PubChem CID 16759010) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is methyl N-[[(1S)-1-acetyl-2-oxocyclopentyl]-(3-methylphenyl)methyl]carbamate.
| Compound Name | methyl N-[[(1S)-1-acetyl-2-oxocyclopentyl]-(3-methylphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 16759010 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | methyl N-[[(1S)-1-acetyl-2-oxocyclopentyl]-(3-methylphenyl)methyl]carbamate |
| SMILES | COC(=O)NC(c1cccc(C)c1)[C@]1(C(C)=O)CCCC1=O |
| InChI | InChI=1S/C17H21NO4/c1-11-6-4-7-13(10-11)15(18-16(21)22-3)17(12(2)19)9-5-8-14(17)20/h4,6-7,10,15H,5,8-9H2,1-3H3,(H,18,21)/t15?,17-/m0/s1 |
| InChIKey | MQNDFKIVIVHMHK-LWKPJOBUSA-N |
| XLogP | 2.72 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|