C22H34NO7P — CID 102475270
tert-butyl N-[(R)-[(1S)-1-diethoxyphosphoryl-2-oxocyclopentyl]-(3-methoxyphenyl)methyl]carbamate (PubChem CID 102475270) has the molecular formula C22H34NO7P and a molecular weight of 455.49 g/mol. Its IUPAC name is tert-butyl N-[(R)-[(1S)-1-diethoxyphosphoryl-2-oxocyclopentyl]-(3-methoxyphenyl)methyl]carbamate.
| Compound Name | tert-butyl N-[(R)-[(1S)-1-diethoxyphosphoryl-2-oxocyclopentyl]-(3-methoxyphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 102475270 |
| Molecular Formula | C22H34NO7P |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | tert-butyl N-[(R)-[(1S)-1-diethoxyphosphoryl-2-oxocyclopentyl]-(3-methoxyphenyl)methyl]carbamate |
| SMILES | CCOP(=O)(OCC)[C@]1([C@H](NC(=O)OC(C)(C)C)c2cccc(OC)c2)CCCC1=O |
| InChI | InChI=1S/C22H34NO7P/c1-7-28-31(26,29-8-2)22(14-10-13-18(22)24)19(23-20(25)30-21(3,4)5)16-11-9-12-17(15-16)27-6/h9,11-12,15,19H,7-8,10,13-14H2,1-6H3,(H,23,25)/t19-,22-/m1/s1 |
| InChIKey | VVCHXFMMIQHSTN-DENIHFKCSA-N |
| XLogP | 5.02 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|